C17H20F3N3O3S — CID 90494818
4-[(2-methylimidazol-1-yl)methyl]-1-[4-(trifluoromethoxy)phenyl]sulfonylpiperidine (PubChem CID 90494818) has the molecular formula C17H20F3N3O3S and a molecular weight of 403.43 g/mol. Its IUPAC name is 4-[(2-methylimidazol-1-yl)methyl]-1-[4-(trifluoromethoxy)phenyl]sulfonylpiperidine.
| Compound Name | 4-[(2-methylimidazol-1-yl)methyl]-1-[4-(trifluoromethoxy)phenyl]sulfonylpiperidine |
|---|---|
| PubChem CID | 90494818 |
| Molecular Formula | C17H20F3N3O3S |
| Molecular Weight | 403.43 g/mol |
| Exact Mass | 403.12 |
| IUPAC Name | 4-[(2-methylimidazol-1-yl)methyl]-1-[4-(trifluoromethoxy)phenyl]sulfonylpiperidine |
| SMILES | Cc1nccn1CC1CCN(S(=O)(=O)c2ccc(OC(F)(F)F)cc2)CC1 |
| InChI | InChI=1S/C17H20F3N3O3S/c1-13-21-8-11-22(13)12-14-6-9-23(10-7-14)27(24,25)16-4-2-15(3-5-16)26-17(18,19)20/h2-5,8,11,14H,6-7,9-10,12H2,1H3 |
| InChIKey | WPZBMQAGHQMDFP-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 64.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.43 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |