C20H24F3NO4S — CID 58065337
(E)-1-cyclopropyl-3-methyl-4-[1-[4-(trifluoromethoxy)phenyl]sulfonylpiperidin-4-yl]but-3-en-2-one (PubChem CID 58065337) has the molecular formula C20H24F3NO4S and a molecular weight of 431.48 g/mol. Its IUPAC name is (E)-1-cyclopropyl-3-methyl-4-[1-[4-(trifluoromethoxy)phenyl]sulfonylpiperidin-4-yl]but-3-en-2-one.
| Compound Name | (E)-1-cyclopropyl-3-methyl-4-[1-[4-(trifluoromethoxy)phenyl]sulfonylpiperidin-4-yl]but-3-en-2-one |
|---|---|
| PubChem CID | 58065337 |
| Molecular Formula | C20H24F3NO4S |
| Molecular Weight | 431.48 g/mol |
| Exact Mass | 431.14 |
| IUPAC Name | (E)-1-cyclopropyl-3-methyl-4-[1-[4-(trifluoromethoxy)phenyl]sulfonylpiperidin-4-yl]but-3-en-2-one |
| SMILES | C/C(=C\C1CCN(S(=O)(=O)c2ccc(OC(F)(F)F)cc2)CC1)C(=O)CC1CC1 |
| InChI | InChI=1S/C20H24F3NO4S/c1-14(19(25)13-15-2-3-15)12-16-8-10-24(11-9-16)29(26,27)18-6-4-17(5-7-18)28-20(21,22)23/h4-7,12,15-16H,2-3,8-11,13H2,1H3/b14-12+ |
| InChIKey | WBSVKOPQPNJCBM-WYMLVPIESA-N |
| XLogP | 4.30 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.48 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|