C20H24F3NO5S — CID 58065358
(Z)-1-cyclopropyl-4-methoxy-4-[1-[4-(trifluoromethoxy)phenyl]sulfonylpiperidin-4-yl]but-3-en-2-one (PubChem CID 58065358) has the molecular formula C20H24F3NO5S and a molecular weight of 447.48 g/mol. Its IUPAC name is (Z)-1-cyclopropyl-4-methoxy-4-[1-[4-(trifluoromethoxy)phenyl]sulfonylpiperidin-4-yl]but-3-en-2-one.
| Compound Name | (Z)-1-cyclopropyl-4-methoxy-4-[1-[4-(trifluoromethoxy)phenyl]sulfonylpiperidin-4-yl]but-3-en-2-one |
|---|---|
| PubChem CID | 58065358 |
| Molecular Formula | C20H24F3NO5S |
| Molecular Weight | 447.48 g/mol |
| Exact Mass | 447.13 |
| IUPAC Name | (Z)-1-cyclopropyl-4-methoxy-4-[1-[4-(trifluoromethoxy)phenyl]sulfonylpiperidin-4-yl]but-3-en-2-one |
| SMILES | CO/C(=C\C(=O)CC1CC1)C1CCN(S(=O)(=O)c2ccc(OC(F)(F)F)cc2)CC1 |
| InChI | InChI=1S/C20H24F3NO5S/c1-28-19(13-16(25)12-14-2-3-14)15-8-10-24(11-9-15)30(26,27)18-6-4-17(5-7-18)29-20(21,22)23/h4-7,13-15H,2-3,8-12H2,1H3/b19-13- |
| InChIKey | LDFFNENEIYKGFM-UYRXBGFRSA-N |
| XLogP | 3.89 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.48 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|