C20H22F3N3O6S — CID 87275451
1-(4-methoxyphenyl)-3-[1-[4-(trifluoromethoxy)phenyl]sulfonylpiperidin-4-yl]oxyurea (PubChem CID 87275451) has the molecular formula C20H22F3N3O6S and a molecular weight of 489.47 g/mol. Its IUPAC name is 1-(4-methoxyphenyl)-3-[1-[4-(trifluoromethoxy)phenyl]sulfonylpiperidin-4-yl]oxyurea.
| Compound Name | 1-(4-methoxyphenyl)-3-[1-[4-(trifluoromethoxy)phenyl]sulfonylpiperidin-4-yl]oxyurea |
|---|---|
| PubChem CID | 87275451 |
| Molecular Formula | C20H22F3N3O6S |
| Molecular Weight | 489.47 g/mol |
| Exact Mass | 489.12 |
| IUPAC Name | 1-(4-methoxyphenyl)-3-[1-[4-(trifluoromethoxy)phenyl]sulfonylpiperidin-4-yl]oxyurea |
| SMILES | COc1ccc(NC(=O)NOC2CCN(S(=O)(=O)c3ccc(OC(F)(F)F)cc3)CC2)cc1 |
| InChI | InChI=1S/C20H22F3N3O6S/c1-30-15-4-2-14(3-5-15)24-19(27)25-32-17-10-12-26(13-11-17)33(28,29)18-8-6-16(7-9-18)31-20(21,22)23/h2-9,17H,10-13H2,1H3,(H2,24,25,27) |
| InChIKey | UXTWMRMKNLWCKA-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 106.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.47 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|