C19H20F3N3O5S — CID 58235347
1-(4-methylphenyl)-3-[(3S)-1-[4-(trifluoromethoxy)phenyl]sulfonylpyrrolidin-3-yl]oxyurea (PubChem CID 58235347) has the molecular formula C19H20F3N3O5S and a molecular weight of 459.45 g/mol. Its IUPAC name is 1-(4-methylphenyl)-3-[(3S)-1-[4-(trifluoromethoxy)phenyl]sulfonylpyrrolidin-3-yl]oxyurea.
| Compound Name | 1-(4-methylphenyl)-3-[(3S)-1-[4-(trifluoromethoxy)phenyl]sulfonylpyrrolidin-3-yl]oxyurea |
|---|---|
| PubChem CID | 58235347 |
| Molecular Formula | C19H20F3N3O5S |
| Molecular Weight | 459.45 g/mol |
| Exact Mass | 459.11 |
| IUPAC Name | 1-(4-methylphenyl)-3-[(3S)-1-[4-(trifluoromethoxy)phenyl]sulfonylpyrrolidin-3-yl]oxyurea |
| SMILES | Cc1ccc(NC(=O)NO[C@H]2CCN(S(=O)(=O)c3ccc(OC(F)(F)F)cc3)C2)cc1 |
| InChI | InChI=1S/C19H20F3N3O5S/c1-13-2-4-14(5-3-13)23-18(26)24-30-16-10-11-25(12-16)31(27,28)17-8-6-15(7-9-17)29-19(20,21)22/h2-9,16H,10-12H2,1H3,(H2,23,24,26)/t16-/m0/s1 |
| InChIKey | WHCGANKHZHJVRR-INIZCTEOSA-N |
| XLogP | 3.41 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.45 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|