C21H23F4N3O3 — CID 87275446
1-(4-fluorophenyl)-3-[1-[1-[4-(trifluoromethoxy)phenyl]ethyl]piperidin-4-yl]oxyurea (PubChem CID 87275446) has the molecular formula C21H23F4N3O3 and a molecular weight of 441.43 g/mol. Its IUPAC name is 1-(4-fluorophenyl)-3-[1-[1-[4-(trifluoromethoxy)phenyl]ethyl]piperidin-4-yl]oxyurea.
| Compound Name | 1-(4-fluorophenyl)-3-[1-[1-[4-(trifluoromethoxy)phenyl]ethyl]piperidin-4-yl]oxyurea |
|---|---|
| PubChem CID | 87275446 |
| Molecular Formula | C21H23F4N3O3 |
| Molecular Weight | 441.43 g/mol |
| Exact Mass | 441.17 |
| IUPAC Name | 1-(4-fluorophenyl)-3-[1-[1-[4-(trifluoromethoxy)phenyl]ethyl]piperidin-4-yl]oxyurea |
| SMILES | CC(c1ccc(OC(F)(F)F)cc1)N1CCC(ONC(=O)Nc2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C21H23F4N3O3/c1-14(15-2-8-18(9-3-15)30-21(23,24)25)28-12-10-19(11-13-28)31-27-20(29)26-17-6-4-16(22)5-7-17/h2-9,14,19H,10-13H2,1H3,(H2,26,27,29) |
| InChIKey | BRYIPWXUJWKICV-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 62.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.43 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|