C19H29FN4O4S — CID 44553624
1-[1-(azocan-1-ylsulfonyl)piperidin-4-yl]oxy-3-(4-fluorophenyl)urea (PubChem CID 44553624) has the molecular formula C19H29FN4O4S and a molecular weight of 428.53 g/mol. Its IUPAC name is 1-[1-(azocan-1-ylsulfonyl)piperidin-4-yl]oxy-3-(4-fluorophenyl)urea.
| Compound Name | 1-[1-(azocan-1-ylsulfonyl)piperidin-4-yl]oxy-3-(4-fluorophenyl)urea |
|---|---|
| PubChem CID | 44553624 |
| Molecular Formula | C19H29FN4O4S |
| Molecular Weight | 428.53 g/mol |
| Exact Mass | 428.19 |
| IUPAC Name | 1-[1-(azocan-1-ylsulfonyl)piperidin-4-yl]oxy-3-(4-fluorophenyl)urea |
| SMILES | O=C(NOC1CCN(S(=O)(=O)N2CCCCCCC2)CC1)Nc1ccc(F)cc1 |
| InChI | InChI=1S/C19H29FN4O4S/c20-16-6-8-17(9-7-16)21-19(25)22-28-18-10-14-24(15-11-18)29(26,27)23-12-4-2-1-3-5-13-23/h6-9,18H,1-5,10-15H2,(H2,21,22,25) |
| InChIKey | FVXSYJALXZTARV-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 90.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.53 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|