C18H22F3NO6S — CID 140660182
ethyl (Z)-3-methoxy-3-[1-[4-(trifluoromethoxy)phenyl]sulfonylpiperidin-4-yl]prop-2-enoate (PubChem CID 140660182) has the molecular formula C18H22F3NO6S and a molecular weight of 437.44 g/mol. Its IUPAC name is ethyl (Z)-3-methoxy-3-[1-[4-(trifluoromethoxy)phenyl]sulfonylpiperidin-4-yl]prop-2-enoate.
| Compound Name | ethyl (Z)-3-methoxy-3-[1-[4-(trifluoromethoxy)phenyl]sulfonylpiperidin-4-yl]prop-2-enoate |
|---|---|
| PubChem CID | 140660182 |
| Molecular Formula | C18H22F3NO6S |
| Molecular Weight | 437.44 g/mol |
| Exact Mass | 437.11 |
| IUPAC Name | ethyl (Z)-3-methoxy-3-[1-[4-(trifluoromethoxy)phenyl]sulfonylpiperidin-4-yl]prop-2-enoate |
| SMILES | CCOC(=O)/C=C(\OC)C1CCN(S(=O)(=O)c2ccc(OC(F)(F)F)cc2)CC1 |
| InChI | InChI=1S/C18H22F3NO6S/c1-3-27-17(23)12-16(26-2)13-8-10-22(11-9-13)29(24,25)15-6-4-14(5-7-15)28-18(19,20)21/h4-7,12-13H,3,8-11H2,1-2H3/b16-12- |
| InChIKey | PPYITTOXXXRKSH-VBKFSLOCSA-N |
| XLogP | 3.08 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.44 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|