C18H22F3N3O2S — CID 90494143
4-[(2-ethylimidazol-1-yl)methyl]-1-[4-(trifluoromethyl)phenyl]sulfonylpiperidine (PubChem CID 90494143) has the molecular formula C18H22F3N3O2S and a molecular weight of 401.45 g/mol. Its IUPAC name is 4-[(2-ethylimidazol-1-yl)methyl]-1-[4-(trifluoromethyl)phenyl]sulfonylpiperidine.
| Compound Name | 4-[(2-ethylimidazol-1-yl)methyl]-1-[4-(trifluoromethyl)phenyl]sulfonylpiperidine |
|---|---|
| PubChem CID | 90494143 |
| Molecular Formula | C18H22F3N3O2S |
| Molecular Weight | 401.45 g/mol |
| Exact Mass | 401.14 |
| IUPAC Name | 4-[(2-ethylimidazol-1-yl)methyl]-1-[4-(trifluoromethyl)phenyl]sulfonylpiperidine |
| SMILES | CCc1nccn1CC1CCN(S(=O)(=O)c2ccc(C(F)(F)F)cc2)CC1 |
| InChI | InChI=1S/C18H22F3N3O2S/c1-2-17-22-9-12-23(17)13-14-7-10-24(11-8-14)27(25,26)16-5-3-15(4-6-16)18(19,20)21/h3-6,9,12,14H,2,7-8,10-11,13H2,1H3 |
| InChIKey | ISNNOQIEEZJVBS-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 55.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.45 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |