C9H14N2 — CID 63811309
1-(cyclopropylmethyl)-2-ethylimidazole (PubChem CID 63811309) has the molecular formula C9H14N2 and a molecular weight of 150.22 g/mol. Its IUPAC name is 1-(cyclopropylmethyl)-2-ethylimidazole.
| Compound Name | 1-(cyclopropylmethyl)-2-ethylimidazole |
|---|---|
| PubChem CID | 63811309 |
| Molecular Formula | C9H14N2 |
| Molecular Weight | 150.22 g/mol |
| Exact Mass | 150.12 |
| IUPAC Name | 1-(cyclopropylmethyl)-2-ethylimidazole |
| SMILES | CCc1nccn1CC1CC1 |
| InChI | InChI=1S/C9H14N2/c1-2-9-10-5-6-11(9)7-8-3-4-8/h5-6,8H,2-4,7H2,1H3 |
| InChIKey | QNCDEPSMPSLIBT-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 150.22 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |