C19H33N3O — CID 90492731
1-[4-[(2-ethylimidazol-1-yl)methyl]piperidin-1-yl]-2-propylpentan-1-one (PubChem CID 90492731) has the molecular formula C19H33N3O and a molecular weight of 319.49 g/mol. Its IUPAC name is 1-[4-[(2-ethylimidazol-1-yl)methyl]piperidin-1-yl]-2-propylpentan-1-one.
| Compound Name | 1-[4-[(2-ethylimidazol-1-yl)methyl]piperidin-1-yl]-2-propylpentan-1-one |
|---|---|
| PubChem CID | 90492731 |
| Molecular Formula | C19H33N3O |
| Molecular Weight | 319.49 g/mol |
| Exact Mass | 319.26 |
| IUPAC Name | 1-[4-[(2-ethylimidazol-1-yl)methyl]piperidin-1-yl]-2-propylpentan-1-one |
| SMILES | CCCC(CCC)C(=O)N1CCC(Cn2ccnc2CC)CC1 |
| InChI | InChI=1S/C19H33N3O/c1-4-7-17(8-5-2)19(23)21-12-9-16(10-13-21)15-22-14-11-20-18(22)6-3/h11,14,16-17H,4-10,12-13,15H2,1-3H3 |
| InChIKey | IXXYYQGBKKRJLG-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 38.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.49 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |