C17H30N4O — CID 42111025
1-[4-(1-ethylimidazol-2-yl)piperazin-1-yl]-2-propylpentan-1-one (PubChem CID 42111025) has the molecular formula C17H30N4O and a molecular weight of 306.45 g/mol. Its IUPAC name is 1-[4-(1-ethylimidazol-2-yl)piperazin-1-yl]-2-propylpentan-1-one.
| Compound Name | 1-[4-(1-ethylimidazol-2-yl)piperazin-1-yl]-2-propylpentan-1-one |
|---|---|
| PubChem CID | 42111025 |
| Molecular Formula | C17H30N4O |
| Molecular Weight | 306.45 g/mol |
| Exact Mass | 306.24 |
| IUPAC Name | 1-[4-(1-ethylimidazol-2-yl)piperazin-1-yl]-2-propylpentan-1-one |
| SMILES | CCCC(CCC)C(=O)N1CCN(c2nccn2CC)CC1 |
| InChI | InChI=1S/C17H30N4O/c1-4-7-15(8-5-2)16(22)20-11-13-21(14-12-20)17-18-9-10-19(17)6-3/h9-10,15H,4-8,11-14H2,1-3H3 |
| InChIKey | PVLCZSPFHNBKRS-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 41.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.45 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |