C17H19F3N4O — CID 25284890
[4-(1-ethylimidazol-2-yl)piperazin-1-yl]-[2-(trifluoromethyl)phenyl]methanone (PubChem CID 25284890) has the molecular formula C17H19F3N4O and a molecular weight of 352.36 g/mol. Its IUPAC name is [4-(1-ethylimidazol-2-yl)piperazin-1-yl]-[2-(trifluoromethyl)phenyl]methanone.
| Compound Name | [4-(1-ethylimidazol-2-yl)piperazin-1-yl]-[2-(trifluoromethyl)phenyl]methanone |
|---|---|
| PubChem CID | 25284890 |
| Molecular Formula | C17H19F3N4O |
| Molecular Weight | 352.36 g/mol |
| Exact Mass | 352.15 |
| IUPAC Name | [4-(1-ethylimidazol-2-yl)piperazin-1-yl]-[2-(trifluoromethyl)phenyl]methanone |
| SMILES | CCn1ccnc1N1CCN(C(=O)c2ccccc2C(F)(F)F)CC1 |
| InChI | InChI=1S/C17H19F3N4O/c1-2-22-8-7-21-16(22)24-11-9-23(10-12-24)15(25)13-5-3-4-6-14(13)17(18,19)20/h3-8H,2,9-12H2,1H3 |
| InChIKey | SPTHYSLAWTZAPZ-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 41.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.36 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |