C20H20F3N3O2S — CID 55996701
(2-ethylsulfanyl-4-pyridinyl)-[4-[2-(trifluoromethyl)benzoyl]piperazin-1-yl]methanone (PubChem CID 55996701) has the molecular formula C20H20F3N3O2S and a molecular weight of 423.46 g/mol. Its IUPAC name is (2-ethylsulfanyl-4-pyridinyl)-[4-[2-(trifluoromethyl)benzoyl]piperazin-1-yl]methanone.
| Compound Name | (2-ethylsulfanyl-4-pyridinyl)-[4-[2-(trifluoromethyl)benzoyl]piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 55996701 |
| Molecular Formula | C20H20F3N3O2S |
| Molecular Weight | 423.46 g/mol |
| Exact Mass | 423.12 |
| IUPAC Name | (2-ethylsulfanyl-4-pyridinyl)-[4-[2-(trifluoromethyl)benzoyl]piperazin-1-yl]methanone |
| SMILES | CCSc1cc(C(=O)N2CCN(C(=O)c3ccccc3C(F)(F)F)CC2)ccn1 |
| InChI | InChI=1S/C20H20F3N3O2S/c1-2-29-17-13-14(7-8-24-17)18(27)25-9-11-26(12-10-25)19(28)15-5-3-4-6-16(15)20(21,22)23/h3-8,13H,2,9-12H2,1H3 |
| InChIKey | ICRDGJXIYGDBPP-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 53.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.46 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |