C18H31ClN4O — CID 45284187
3-cyclohexyl-1-[4-(1-ethylimidazol-2-yl)piperazin-1-yl]propan-1-one;hydrochloride (PubChem CID 45284187) has the molecular formula C18H31ClN4O and a molecular weight of 354.93 g/mol. Its IUPAC name is 3-cyclohexyl-1-[4-(1-ethylimidazol-2-yl)piperazin-1-yl]propan-1-one;hydrochloride.
| Compound Name | 3-cyclohexyl-1-[4-(1-ethylimidazol-2-yl)piperazin-1-yl]propan-1-one;hydrochloride |
|---|---|
| PubChem CID | 45284187 |
| Molecular Formula | C18H31ClN4O |
| Molecular Weight | 354.93 g/mol |
| Exact Mass | 354.22 |
| IUPAC Name | 3-cyclohexyl-1-[4-(1-ethylimidazol-2-yl)piperazin-1-yl]propan-1-one;hydrochloride |
| SMILES | CCn1ccnc1N1CCN(C(=O)CCC2CCCCC2)CC1.Cl |
| InChI | InChI=1S/C18H30N4O.ClH/c1-2-20-11-10-19-18(20)22-14-12-21(13-15-22)17(23)9-8-16-6-4-3-5-7-16;/h10-11,16H,2-9,12-15H2,1H3;1H |
| InChIKey | KTAIFPUMIUOFFG-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 41.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.93 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |