C18H33N3O2 — CID 108569569
4-(3-cyclohexylpropanoyl)-N,N-diethylpiperazine-1-carboxamide (PubChem CID 108569569) has the molecular formula C18H33N3O2 and a molecular weight of 323.48 g/mol. Its IUPAC name is 4-(3-cyclohexylpropanoyl)-N,N-diethylpiperazine-1-carboxamide.
| Compound Name | 4-(3-cyclohexylpropanoyl)-N,N-diethylpiperazine-1-carboxamide |
|---|---|
| PubChem CID | 108569569 |
| Molecular Formula | C18H33N3O2 |
| Molecular Weight | 323.48 g/mol |
| Exact Mass | 323.26 |
| IUPAC Name | 4-(3-cyclohexylpropanoyl)-N,N-diethylpiperazine-1-carboxamide |
| SMILES | CCN(CC)C(=O)N1CCN(C(=O)CCC2CCCCC2)CC1 |
| InChI | InChI=1S/C18H33N3O2/c1-3-19(4-2)18(23)21-14-12-20(13-15-21)17(22)11-10-16-8-6-5-7-9-16/h16H,3-15H2,1-2H3 |
| InChIKey | LOPMDGPMJZZXSO-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 43.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.48 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |