C19H35N3O2 — CID 108561969
4-(3-cyclohexylpropanoylamino)-N,N-diethylpiperidine-1-carboxamide (PubChem CID 108561969) has the molecular formula C19H35N3O2 and a molecular weight of 337.51 g/mol. Its IUPAC name is 4-(3-cyclohexylpropanoylamino)-N,N-diethylpiperidine-1-carboxamide.
| Compound Name | 4-(3-cyclohexylpropanoylamino)-N,N-diethylpiperidine-1-carboxamide |
|---|---|
| PubChem CID | 108561969 |
| Molecular Formula | C19H35N3O2 |
| Molecular Weight | 337.51 g/mol |
| Exact Mass | 337.27 |
| IUPAC Name | 4-(3-cyclohexylpropanoylamino)-N,N-diethylpiperidine-1-carboxamide |
| SMILES | CCN(CC)C(=O)N1CCC(NC(=O)CCC2CCCCC2)CC1 |
| InChI | InChI=1S/C19H35N3O2/c1-3-21(4-2)19(24)22-14-12-17(13-15-22)20-18(23)11-10-16-8-6-5-7-9-16/h16-17H,3-15H2,1-2H3,(H,20,23) |
| InChIKey | LPNYWVYHVALABQ-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.51 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |