C17H29ClN2O2 — CID 108566205
2-chloro-N-[1-(3-cyclohexylpropanoyl)piperidin-4-yl]propanamide (PubChem CID 108566205) has the molecular formula C17H29ClN2O2 and a molecular weight of 328.88 g/mol. Its IUPAC name is 2-chloro-N-[1-(3-cyclohexylpropanoyl)piperidin-4-yl]propanamide.
| Compound Name | 2-chloro-N-[1-(3-cyclohexylpropanoyl)piperidin-4-yl]propanamide |
|---|---|
| PubChem CID | 108566205 |
| Molecular Formula | C17H29ClN2O2 |
| Molecular Weight | 328.88 g/mol |
| Exact Mass | 328.19 |
| IUPAC Name | 2-chloro-N-[1-(3-cyclohexylpropanoyl)piperidin-4-yl]propanamide |
| SMILES | CC(Cl)C(=O)NC1CCN(C(=O)CCC2CCCCC2)CC1 |
| InChI | InChI=1S/C17H29ClN2O2/c1-13(18)17(22)19-15-9-11-20(12-10-15)16(21)8-7-14-5-3-2-4-6-14/h13-15H,2-12H2,1H3,(H,19,22) |
| InChIKey | BEGVMCXNAOKGRH-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.88 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|