C21H30N2O2S — CID 108554734
N-[1-(3-cyclohexylpropanoyl)piperidin-4-yl]-2-sulfanylbenzamide (PubChem CID 108554734) has the molecular formula C21H30N2O2S and a molecular weight of 374.55 g/mol. Its IUPAC name is N-[1-(3-cyclohexylpropanoyl)piperidin-4-yl]-2-sulfanylbenzamide.
| Compound Name | N-[1-(3-cyclohexylpropanoyl)piperidin-4-yl]-2-sulfanylbenzamide |
|---|---|
| PubChem CID | 108554734 |
| Molecular Formula | C21H30N2O2S |
| Molecular Weight | 374.55 g/mol |
| Exact Mass | 374.20 |
| IUPAC Name | N-[1-(3-cyclohexylpropanoyl)piperidin-4-yl]-2-sulfanylbenzamide |
| SMILES | O=C(NC1CCN(C(=O)CCC2CCCCC2)CC1)c1ccccc1S |
| InChI | InChI=1S/C21H30N2O2S/c24-20(11-10-16-6-2-1-3-7-16)23-14-12-17(13-15-23)22-21(25)18-8-4-5-9-19(18)26/h4-5,8-9,16-17,26H,1-3,6-7,10-15H2,(H,22,25) |
| InChIKey | OAJUFTGERRXAKU-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.55 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|