C23H34N2O4 — CID 108555663
3-cyclohexyl-N-[1-(2,6-dimethoxybenzoyl)piperidin-4-yl]propanamide (PubChem CID 108555663) has the molecular formula C23H34N2O4 and a molecular weight of 402.54 g/mol. Its IUPAC name is 3-cyclohexyl-N-[1-(2,6-dimethoxybenzoyl)piperidin-4-yl]propanamide.
| Compound Name | 3-cyclohexyl-N-[1-(2,6-dimethoxybenzoyl)piperidin-4-yl]propanamide |
|---|---|
| PubChem CID | 108555663 |
| Molecular Formula | C23H34N2O4 |
| Molecular Weight | 402.54 g/mol |
| Exact Mass | 402.25 |
| IUPAC Name | 3-cyclohexyl-N-[1-(2,6-dimethoxybenzoyl)piperidin-4-yl]propanamide |
| SMILES | COc1cccc(OC)c1C(=O)N1CCC(NC(=O)CCC2CCCCC2)CC1 |
| InChI | InChI=1S/C23H34N2O4/c1-28-19-9-6-10-20(29-2)22(19)23(27)25-15-13-18(14-16-25)24-21(26)12-11-17-7-4-3-5-8-17/h6,9-10,17-18H,3-5,7-8,11-16H2,1-2H3,(H,24,26) |
| InChIKey | SRXVBTSERMGCSJ-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.54 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |