C21H36N4O — CID 90561013
3-cyclohexyl-1-[4-[2-(2-propan-2-ylimidazol-1-yl)ethyl]piperazin-1-yl]propan-1-one (PubChem CID 90561013) has the molecular formula C21H36N4O and a molecular weight of 360.55 g/mol. Its IUPAC name is 3-cyclohexyl-1-[4-[2-(2-propan-2-ylimidazol-1-yl)ethyl]piperazin-1-yl]propan-1-one.
| Compound Name | 3-cyclohexyl-1-[4-[2-(2-propan-2-ylimidazol-1-yl)ethyl]piperazin-1-yl]propan-1-one |
|---|---|
| PubChem CID | 90561013 |
| Molecular Formula | C21H36N4O |
| Molecular Weight | 360.55 g/mol |
| Exact Mass | 360.29 |
| IUPAC Name | 3-cyclohexyl-1-[4-[2-(2-propan-2-ylimidazol-1-yl)ethyl]piperazin-1-yl]propan-1-one |
| SMILES | CC(C)c1nccn1CCN1CCN(C(=O)CCC2CCCCC2)CC1 |
| InChI | InChI=1S/C21H36N4O/c1-18(2)21-22-10-11-25(21)17-14-23-12-15-24(16-13-23)20(26)9-8-19-6-4-3-5-7-19/h10-11,18-19H,3-9,12-17H2,1-2H3 |
| InChIKey | NFWLKRISYIUNFR-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 41.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.55 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |