C13H22N4O2 — CID 113331263
methyl 3-[4-(1-ethylimidazol-2-yl)piperazin-1-yl]propanoate (PubChem CID 113331263) has the molecular formula C13H22N4O2 and a molecular weight of 266.34 g/mol. Its IUPAC name is methyl 3-[4-(1-ethylimidazol-2-yl)piperazin-1-yl]propanoate.
| Compound Name | methyl 3-[4-(1-ethylimidazol-2-yl)piperazin-1-yl]propanoate |
|---|---|
| PubChem CID | 113331263 |
| Molecular Formula | C13H22N4O2 |
| Molecular Weight | 266.34 g/mol |
| Exact Mass | 266.17 |
| IUPAC Name | methyl 3-[4-(1-ethylimidazol-2-yl)piperazin-1-yl]propanoate |
| SMILES | CCn1ccnc1N1CCN(CCC(=O)OC)CC1 |
| InChI | InChI=1S/C13H22N4O2/c1-3-16-7-5-14-13(16)17-10-8-15(9-11-17)6-4-12(18)19-2/h5,7H,3-4,6,8-11H2,1-2H3 |
| InChIKey | XJTNHPXTHFHMPE-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 50.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.34 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |