methyl 3-[4-(6-ethoxypyrazin-2-yl)piperazin-1-yl]propanoate

C14H22N4O3 — CID 81422160

IUPACmethyl 3-[4-(6-ethoxypyrazin-2-yl)piperazin-1-yl]propanoate
SMILESCCOc1cncc(N2CCN(CCC(=O)OC)CC2)n1
InChIInChI=1S/C14H22N4O3/c1-3-21-13-11-15-10-12(16-13)18-8-6-17(7-9-18)5-4-14(19)20-2/h10-11H,3-9H2,1-2H3
InChIKeyUUPBAINWIWBKGU-UHFFFAOYSA-N
MW294.36 g/mol
LogP0.56
Rot. Bonds6

About methyl 3-[4-(6-ethoxypyrazin-2-yl)piperazin-1-yl]propanoate

methyl 3-[4-(6-ethoxypyrazin-2-yl)piperazin-1-yl]propanoate (PubChem CID 81422160) has the molecular formula C14H22N4O3 and a molecular weight of 294.36 g/mol. Its IUPAC name is methyl 3-[4-(6-ethoxypyrazin-2-yl)piperazin-1-yl]propanoate.

Molecular Properties

Compound Namemethyl 3-[4-(6-ethoxypyrazin-2-yl)piperazin-1-yl]propanoate
PubChem CID81422160
Molecular FormulaC14H22N4O3
Molecular Weight294.36 g/mol
Exact Mass294.17
IUPAC Namemethyl 3-[4-(6-ethoxypyrazin-2-yl)piperazin-1-yl]propanoate
SMILESCCOc1cncc(N2CCN(CCC(=O)OC)CC2)n1
InChIInChI=1S/C14H22N4O3/c1-3-21-13-11-15-10-12(16-13)18-8-6-17(7-9-18)5-4-14(19)20-2/h10-11H,3-9H2,1-2H3
InChIKeyUUPBAINWIWBKGU-UHFFFAOYSA-N
XLogP0.56
TPSA67.79 Ų
H-Bond Donors
H-Bond Acceptors7
Rotatable Bonds6
Heavy Atoms21
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500294.36
LogP ≤ 50.56
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 107

Analyze methyl 3-[4-(6-ethoxypyrazin-2-yl)piperazin-1-yl]propanoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 3-[4-(6-ethoxypyrazin-2-yl)piperazin-1-yl]propanoate?
The IUPAC name of methyl 3-[4-(6-ethoxypyrazin-2-yl)piperazin-1-yl]propanoate (CID 81422160) is methyl 3-[4-(6-ethoxypyrazin-2-yl)piperazin-1-yl]propanoate.
What is the SMILES notation for methyl 3-[4-(6-ethoxypyrazin-2-yl)piperazin-1-yl]propanoate?
The canonical SMILES for methyl 3-[4-(6-ethoxypyrazin-2-yl)piperazin-1-yl]propanoate is CCOc1cncc(N2CCN(CCC(=O)OC)CC2)n1.
What is the InChIKey of methyl 3-[4-(6-ethoxypyrazin-2-yl)piperazin-1-yl]propanoate?
The InChIKey is UUPBAINWIWBKGU-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H22N4O3/c1-3-21-13-11-15-10-12(16-13)18-8-6-17(7-9-18)5-4-14(19)20-2/h10-11H,3-9H2,1-2H3.
What are the key properties of methyl 3-[4-(6-ethoxypyrazin-2-yl)piperazin-1-yl]propanoate?
methyl 3-[4-(6-ethoxypyrazin-2-yl)piperazin-1-yl]propanoate has a molecular weight of 294.36 g/mol, XLogP of 0.56, 6 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-[4-(6-ethoxypyrazin-2-yl)piperazin-1-yl]propanoate is sourced from PubChem (CID 81422160), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).