C17H25N3O2S2 — CID 90494131
4-[(2-ethylimidazol-1-yl)methyl]-1-(5-ethylthiophen-2-yl)sulfonylpiperidine (PubChem CID 90494131) has the molecular formula C17H25N3O2S2 and a molecular weight of 367.54 g/mol. Its IUPAC name is 4-[(2-ethylimidazol-1-yl)methyl]-1-(5-ethylthiophen-2-yl)sulfonylpiperidine.
| Compound Name | 4-[(2-ethylimidazol-1-yl)methyl]-1-(5-ethylthiophen-2-yl)sulfonylpiperidine |
|---|---|
| PubChem CID | 90494131 |
| Molecular Formula | C17H25N3O2S2 |
| Molecular Weight | 367.54 g/mol |
| Exact Mass | 367.14 |
| IUPAC Name | 4-[(2-ethylimidazol-1-yl)methyl]-1-(5-ethylthiophen-2-yl)sulfonylpiperidine |
| SMILES | CCc1ccc(S(=O)(=O)N2CCC(Cn3ccnc3CC)CC2)s1 |
| InChI | InChI=1S/C17H25N3O2S2/c1-3-15-5-6-17(23-15)24(21,22)20-10-7-14(8-11-20)13-19-12-9-18-16(19)4-2/h5-6,9,12,14H,3-4,7-8,10-11,13H2,1-2H3 |
| InChIKey | DMDISYJQSSJALY-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 55.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.54 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |