C18H22FNO3S2 — CID 110639091
1-(5-ethylthiophen-2-yl)sulfonyl-4-[(4-fluorophenoxy)methyl]piperidine (PubChem CID 110639091) has the molecular formula C18H22FNO3S2 and a molecular weight of 383.51 g/mol. Its IUPAC name is 1-(5-ethylthiophen-2-yl)sulfonyl-4-[(4-fluorophenoxy)methyl]piperidine.
| Compound Name | 1-(5-ethylthiophen-2-yl)sulfonyl-4-[(4-fluorophenoxy)methyl]piperidine |
|---|---|
| PubChem CID | 110639091 |
| Molecular Formula | C18H22FNO3S2 |
| Molecular Weight | 383.51 g/mol |
| Exact Mass | 383.10 |
| IUPAC Name | 1-(5-ethylthiophen-2-yl)sulfonyl-4-[(4-fluorophenoxy)methyl]piperidine |
| SMILES | CCc1ccc(S(=O)(=O)N2CCC(COc3ccc(F)cc3)CC2)s1 |
| InChI | InChI=1S/C18H22FNO3S2/c1-2-17-7-8-18(24-17)25(21,22)20-11-9-14(10-12-20)13-23-16-5-3-15(19)4-6-16/h3-8,14H,2,9-13H2,1H3 |
| InChIKey | XRAGOXFWMTUTCC-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.51 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |