C20H27N3O2S — CID 90494156
4-[(2-ethylimidazol-1-yl)methyl]-1-[(E)-2-(4-methylphenyl)ethenyl]sulfonylpiperidine (PubChem CID 90494156) has the molecular formula C20H27N3O2S and a molecular weight of 373.52 g/mol. Its IUPAC name is 4-[(2-ethylimidazol-1-yl)methyl]-1-[(E)-2-(4-methylphenyl)ethenyl]sulfonylpiperidine.
| Compound Name | 4-[(2-ethylimidazol-1-yl)methyl]-1-[(E)-2-(4-methylphenyl)ethenyl]sulfonylpiperidine |
|---|---|
| PubChem CID | 90494156 |
| Molecular Formula | C20H27N3O2S |
| Molecular Weight | 373.52 g/mol |
| Exact Mass | 373.18 |
| IUPAC Name | 4-[(2-ethylimidazol-1-yl)methyl]-1-[(E)-2-(4-methylphenyl)ethenyl]sulfonylpiperidine |
| SMILES | CCc1nccn1CC1CCN(S(=O)(=O)/C=C/c2ccc(C)cc2)CC1 |
| InChI | InChI=1S/C20H27N3O2S/c1-3-20-21-11-14-22(20)16-19-8-12-23(13-9-19)26(24,25)15-10-18-6-4-17(2)5-7-18/h4-7,10-11,14-15,19H,3,8-9,12-13,16H2,1-2H3/b15-10+ |
| InChIKey | DMXQGXQRSSUEDP-XNTDXEJSSA-N |
| XLogP | 3.47 |
| TPSA | 55.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.52 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |