C22H29N3O3 — CID 90492770
(E)-3-(3,4-dimethoxyphenyl)-1-[4-[(2-ethylimidazol-1-yl)methyl]piperidin-1-yl]prop-2-en-1-one (PubChem CID 90492770) has the molecular formula C22H29N3O3 and a molecular weight of 383.49 g/mol. Its IUPAC name is (E)-3-(3,4-dimethoxyphenyl)-1-[4-[(2-ethylimidazol-1-yl)methyl]piperidin-1-yl]prop-2-en-1-one.
| Compound Name | (E)-3-(3,4-dimethoxyphenyl)-1-[4-[(2-ethylimidazol-1-yl)methyl]piperidin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 90492770 |
| Molecular Formula | C22H29N3O3 |
| Molecular Weight | 383.49 g/mol |
| Exact Mass | 383.22 |
| IUPAC Name | (E)-3-(3,4-dimethoxyphenyl)-1-[4-[(2-ethylimidazol-1-yl)methyl]piperidin-1-yl]prop-2-en-1-one |
| SMILES | CCc1nccn1CC1CCN(C(=O)/C=C/c2ccc(OC)c(OC)c2)CC1 |
| InChI | InChI=1S/C22H29N3O3/c1-4-21-23-11-14-25(21)16-18-9-12-24(13-10-18)22(26)8-6-17-5-7-19(27-2)20(15-17)28-3/h5-8,11,14-15,18H,4,9-10,12-13,16H2,1-3H3/b8-6+ |
| InChIKey | MQPSMBQAAPEIAF-SOFGYWHQSA-N |
| XLogP | 3.41 |
| TPSA | 56.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.49 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|