C24H29NO4S — CID 71800928
(E)-3-(3,4-dimethoxyphenyl)-1-[4-[(4-methoxyphenyl)sulfanylmethyl]piperidin-1-yl]prop-2-en-1-one (PubChem CID 71800928) has the molecular formula C24H29NO4S and a molecular weight of 427.57 g/mol. Its IUPAC name is (E)-3-(3,4-dimethoxyphenyl)-1-[4-[(4-methoxyphenyl)sulfanylmethyl]piperidin-1-yl]prop-2-en-1-one.
| Compound Name | (E)-3-(3,4-dimethoxyphenyl)-1-[4-[(4-methoxyphenyl)sulfanylmethyl]piperidin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 71800928 |
| Molecular Formula | C24H29NO4S |
| Molecular Weight | 427.57 g/mol |
| Exact Mass | 427.18 |
| IUPAC Name | (E)-3-(3,4-dimethoxyphenyl)-1-[4-[(4-methoxyphenyl)sulfanylmethyl]piperidin-1-yl]prop-2-en-1-one |
| SMILES | COc1ccc(SCC2CCN(C(=O)/C=C/c3ccc(OC)c(OC)c3)CC2)cc1 |
| InChI | InChI=1S/C24H29NO4S/c1-27-20-6-8-21(9-7-20)30-17-19-12-14-25(15-13-19)24(26)11-5-18-4-10-22(28-2)23(16-18)29-3/h4-11,16,19H,12-15,17H2,1-3H3/b11-5+ |
| InChIKey | HIXUNQZLJOTBMM-VZUCSPMQSA-N |
| XLogP | 4.76 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.57 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|