C17H25NO3S — CID 71800916
2-ethoxy-1-[4-[(4-methoxyphenyl)sulfanylmethyl]piperidin-1-yl]ethanone (PubChem CID 71800916) has the molecular formula C17H25NO3S and a molecular weight of 323.46 g/mol. Its IUPAC name is 2-ethoxy-1-[4-[(4-methoxyphenyl)sulfanylmethyl]piperidin-1-yl]ethanone.
| Compound Name | 2-ethoxy-1-[4-[(4-methoxyphenyl)sulfanylmethyl]piperidin-1-yl]ethanone |
|---|---|
| PubChem CID | 71800916 |
| Molecular Formula | C17H25NO3S |
| Molecular Weight | 323.46 g/mol |
| Exact Mass | 323.16 |
| IUPAC Name | 2-ethoxy-1-[4-[(4-methoxyphenyl)sulfanylmethyl]piperidin-1-yl]ethanone |
| SMILES | CCOCC(=O)N1CCC(CSc2ccc(OC)cc2)CC1 |
| InChI | InChI=1S/C17H25NO3S/c1-3-21-12-17(19)18-10-8-14(9-11-18)13-22-16-6-4-15(20-2)5-7-16/h4-7,14H,3,8-13H2,1-2H3 |
| InChIKey | OWMFKNZNVVRJPC-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.46 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |