C21H24FNO2S2 — CID 71800950
2-(4-fluorophenyl)sulfanyl-1-[4-[(4-methoxyphenyl)sulfanylmethyl]piperidin-1-yl]ethanone (PubChem CID 71800950) has the molecular formula C21H24FNO2S2 and a molecular weight of 405.56 g/mol. Its IUPAC name is 2-(4-fluorophenyl)sulfanyl-1-[4-[(4-methoxyphenyl)sulfanylmethyl]piperidin-1-yl]ethanone.
| Compound Name | 2-(4-fluorophenyl)sulfanyl-1-[4-[(4-methoxyphenyl)sulfanylmethyl]piperidin-1-yl]ethanone |
|---|---|
| PubChem CID | 71800950 |
| Molecular Formula | C21H24FNO2S2 |
| Molecular Weight | 405.56 g/mol |
| Exact Mass | 405.12 |
| IUPAC Name | 2-(4-fluorophenyl)sulfanyl-1-[4-[(4-methoxyphenyl)sulfanylmethyl]piperidin-1-yl]ethanone |
| SMILES | COc1ccc(SCC2CCN(C(=O)CSc3ccc(F)cc3)CC2)cc1 |
| InChI | InChI=1S/C21H24FNO2S2/c1-25-18-4-8-20(9-5-18)26-14-16-10-12-23(13-11-16)21(24)15-27-19-6-2-17(22)3-7-19/h2-9,16H,10-15H2,1H3 |
| InChIKey | BGYRTTVJPQIHDY-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.56 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |