C19H26FN3O2S — CID 55717949
2-(4-fluorophenyl)sulfanyl-1-[4-(4-methylpiperazine-1-carbonyl)piperidin-1-yl]ethanone (PubChem CID 55717949) has the molecular formula C19H26FN3O2S and a molecular weight of 379.50 g/mol. Its IUPAC name is 2-(4-fluorophenyl)sulfanyl-1-[4-(4-methylpiperazine-1-carbonyl)piperidin-1-yl]ethanone.
| Compound Name | 2-(4-fluorophenyl)sulfanyl-1-[4-(4-methylpiperazine-1-carbonyl)piperidin-1-yl]ethanone |
|---|---|
| PubChem CID | 55717949 |
| Molecular Formula | C19H26FN3O2S |
| Molecular Weight | 379.50 g/mol |
| Exact Mass | 379.17 |
| IUPAC Name | 2-(4-fluorophenyl)sulfanyl-1-[4-(4-methylpiperazine-1-carbonyl)piperidin-1-yl]ethanone |
| SMILES | CN1CCN(C(=O)C2CCN(C(=O)CSc3ccc(F)cc3)CC2)CC1 |
| InChI | InChI=1S/C19H26FN3O2S/c1-21-10-12-23(13-11-21)19(25)15-6-8-22(9-7-15)18(24)14-26-17-4-2-16(20)3-5-17/h2-5,15H,6-14H2,1H3 |
| InChIKey | FDVFARNUGHNJNG-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 43.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.50 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |