C15H17FN4OS — CID 121151174
2-(4-fluorophenyl)sulfanyl-1-[4-(triazol-1-yl)piperidin-1-yl]ethanone (PubChem CID 121151174) has the molecular formula C15H17FN4OS and a molecular weight of 320.39 g/mol. Its IUPAC name is 2-(4-fluorophenyl)sulfanyl-1-[4-(triazol-1-yl)piperidin-1-yl]ethanone.
| Compound Name | 2-(4-fluorophenyl)sulfanyl-1-[4-(triazol-1-yl)piperidin-1-yl]ethanone |
|---|---|
| PubChem CID | 121151174 |
| Molecular Formula | C15H17FN4OS |
| Molecular Weight | 320.39 g/mol |
| Exact Mass | 320.11 |
| IUPAC Name | 2-(4-fluorophenyl)sulfanyl-1-[4-(triazol-1-yl)piperidin-1-yl]ethanone |
| SMILES | O=C(CSc1ccc(F)cc1)N1CCC(n2ccnn2)CC1 |
| InChI | InChI=1S/C15H17FN4OS/c16-12-1-3-14(4-2-12)22-11-15(21)19-8-5-13(6-9-19)20-10-7-17-18-20/h1-4,7,10,13H,5-6,8-9,11H2 |
| InChIKey | CWDMIPROBSPWKK-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 51.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.39 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |