C22H25FN2O2S — CID 38028139
2-(4-fluorophenyl)sulfanyl-1-[4-(4-propan-2-ylbenzoyl)piperazin-1-yl]ethanone (PubChem CID 38028139) has the molecular formula C22H25FN2O2S and a molecular weight of 400.52 g/mol. Its IUPAC name is 2-(4-fluorophenyl)sulfanyl-1-[4-(4-propan-2-ylbenzoyl)piperazin-1-yl]ethanone.
| Compound Name | 2-(4-fluorophenyl)sulfanyl-1-[4-(4-propan-2-ylbenzoyl)piperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 38028139 |
| Molecular Formula | C22H25FN2O2S |
| Molecular Weight | 400.52 g/mol |
| Exact Mass | 400.16 |
| IUPAC Name | 2-(4-fluorophenyl)sulfanyl-1-[4-(4-propan-2-ylbenzoyl)piperazin-1-yl]ethanone |
| SMILES | CC(C)c1ccc(C(=O)N2CCN(C(=O)CSc3ccc(F)cc3)CC2)cc1 |
| InChI | InChI=1S/C22H25FN2O2S/c1-16(2)17-3-5-18(6-4-17)22(27)25-13-11-24(12-14-25)21(26)15-28-20-9-7-19(23)8-10-20/h3-10,16H,11-15H2,1-2H3 |
| InChIKey | YHHJUCIYZNDTCZ-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.52 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |