C19H18F2N2O2S — CID 134059953
1-(4-benzoylpiperazin-1-yl)-2-(3,4-difluorophenyl)sulfanylethanone (PubChem CID 134059953) has the molecular formula C19H18F2N2O2S and a molecular weight of 376.43 g/mol. Its IUPAC name is 1-(4-benzoylpiperazin-1-yl)-2-(3,4-difluorophenyl)sulfanylethanone.
| Compound Name | 1-(4-benzoylpiperazin-1-yl)-2-(3,4-difluorophenyl)sulfanylethanone |
|---|---|
| PubChem CID | 134059953 |
| Molecular Formula | C19H18F2N2O2S |
| Molecular Weight | 376.43 g/mol |
| Exact Mass | 376.11 |
| IUPAC Name | 1-(4-benzoylpiperazin-1-yl)-2-(3,4-difluorophenyl)sulfanylethanone |
| SMILES | O=C(CSc1ccc(F)c(F)c1)N1CCN(C(=O)c2ccccc2)CC1 |
| InChI | InChI=1S/C19H18F2N2O2S/c20-16-7-6-15(12-17(16)21)26-13-18(24)22-8-10-23(11-9-22)19(25)14-4-2-1-3-5-14/h1-7,12H,8-11,13H2 |
| InChIKey | JJDHFZUYVVGYOU-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.43 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |