C24H30N2O2S — CID 78848630
1-(4-benzoyl-1,4-diazepan-1-yl)-2-(4-tert-butylphenyl)sulfanylethanone (PubChem CID 78848630) has the molecular formula C24H30N2O2S and a molecular weight of 410.58 g/mol. Its IUPAC name is 1-(4-benzoyl-1,4-diazepan-1-yl)-2-(4-tert-butylphenyl)sulfanylethanone.
| Compound Name | 1-(4-benzoyl-1,4-diazepan-1-yl)-2-(4-tert-butylphenyl)sulfanylethanone |
|---|---|
| PubChem CID | 78848630 |
| Molecular Formula | C24H30N2O2S |
| Molecular Weight | 410.58 g/mol |
| Exact Mass | 410.20 |
| IUPAC Name | 1-(4-benzoyl-1,4-diazepan-1-yl)-2-(4-tert-butylphenyl)sulfanylethanone |
| SMILES | CC(C)(C)c1ccc(SCC(=O)N2CCCN(C(=O)c3ccccc3)CC2)cc1 |
| InChI | InChI=1S/C24H30N2O2S/c1-24(2,3)20-10-12-21(13-11-20)29-18-22(27)25-14-7-15-26(17-16-25)23(28)19-8-5-4-6-9-19/h4-6,8-13H,7,14-18H2,1-3H3 |
| InChIKey | NDMILDXPACTIDR-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.58 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |