C20H21N3O4S — CID 36615348
1-(4-benzoyl-1,4-diazepan-1-yl)-2-(4-nitrophenyl)sulfanylethanone (PubChem CID 36615348) has the molecular formula C20H21N3O4S and a molecular weight of 399.47 g/mol. Its IUPAC name is 1-(4-benzoyl-1,4-diazepan-1-yl)-2-(4-nitrophenyl)sulfanylethanone.
| Compound Name | 1-(4-benzoyl-1,4-diazepan-1-yl)-2-(4-nitrophenyl)sulfanylethanone |
|---|---|
| PubChem CID | 36615348 |
| Molecular Formula | C20H21N3O4S |
| Molecular Weight | 399.47 g/mol |
| Exact Mass | 399.13 |
| IUPAC Name | 1-(4-benzoyl-1,4-diazepan-1-yl)-2-(4-nitrophenyl)sulfanylethanone |
| SMILES | O=C(CSc1ccc([N+](=O)[O-])cc1)N1CCCN(C(=O)c2ccccc2)CC1 |
| InChI | InChI=1S/C20H21N3O4S/c24-19(15-28-18-9-7-17(8-10-18)23(26)27)21-11-4-12-22(14-13-21)20(25)16-5-2-1-3-6-16/h1-3,5-10H,4,11-15H2 |
| InChIKey | ZRZRWGRQVTWMMC-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 83.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.47 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|