About 1-[2-(3,4-difluorophenyl)sulfanylacetyl]-3-fluoropyrrolidine-3-carboxylic acid
1-[2-(3,4-difluorophenyl)sulfanylacetyl]-3-fluoropyrrolidine-3-carboxylic acid (PubChem CID 119258744) has the molecular formula C13H12F3NO3S
and a molecular weight of 319.30 g/mol. Its IUPAC name is 1-[2-(3,4-difluorophenyl)sulfanylacetyl]-3-fluoropyrrolidine-3-carboxylic acid.
Molecular Properties
| Compound Name | 1-[2-(3,4-difluorophenyl)sulfanylacetyl]-3-fluoropyrrolidine-3-carboxylic acid |
| PubChem CID | 119258744 |
| Molecular Formula | C13H12F3NO3S |
| Molecular Weight | 319.30 g/mol |
| Exact Mass | 319.05 |
| IUPAC Name | 1-[2-(3,4-difluorophenyl)sulfanylacetyl]-3-fluoropyrrolidine-3-carboxylic acid |
| SMILES | O=C(CSc1ccc(F)c(F)c1)N1CCC(F)(C(=O)O)C1 |
| InChI | InChI=1S/C13H12F3NO3S/c14-9-2-1-8(5-10(9)15)21-6-11(18)17-4-3-13(16,7-17)12(19)20/h1-2,5H,3-4,6-7H2,(H,19,20) |
| InChIKey | RIZKZAACXSUCMQ-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 319.30 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-[2-(3,4-difluorophenyl)sulfanylacetyl]-3-fluoropyrrolidine-3-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[2-(3,4-difluorophenyl)sulfanylacetyl]-3-fluoropyrrolidine-3-carboxylic acid?
The IUPAC name of 1-[2-(3,4-difluorophenyl)sulfanylacetyl]-3-fluoropyrrolidine-3-carboxylic acid (CID 119258744) is 1-[2-(3,4-difluorophenyl)sulfanylacetyl]-3-fluoropyrrolidine-3-carboxylic acid.
What is the SMILES notation for 1-[2-(3,4-difluorophenyl)sulfanylacetyl]-3-fluoropyrrolidine-3-carboxylic acid?
The canonical SMILES for 1-[2-(3,4-difluorophenyl)sulfanylacetyl]-3-fluoropyrrolidine-3-carboxylic acid is O=C(CSc1ccc(F)c(F)c1)N1CCC(F)(C(=O)O)C1.
What is the InChIKey of 1-[2-(3,4-difluorophenyl)sulfanylacetyl]-3-fluoropyrrolidine-3-carboxylic acid?
The InChIKey is RIZKZAACXSUCMQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H12F3NO3S/c14-9-2-1-8(5-10(9)15)21-6-11(18)17-4-3-13(16,7-17)12(19)20/h1-2,5H,3-4,6-7H2,(H,19,20).
What are the key properties of 1-[2-(3,4-difluorophenyl)sulfanylacetyl]-3-fluoropyrrolidine-3-carboxylic acid?
1-[2-(3,4-difluorophenyl)sulfanylacetyl]-3-fluoropyrrolidine-3-carboxylic acid has a molecular weight of 319.30 g/mol, XLogP of 2.08, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[2-(3,4-difluorophenyl)sulfanylacetyl]-3-fluoropyrrolidine-3-carboxylic acid is sourced from PubChem (CID 119258744), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).