C13H13ClFNO5S — CID 119259327
1-[2-(4-chlorophenyl)sulfonylacetyl]-3-fluoropyrrolidine-3-carboxylic acid (PubChem CID 119259327) has the molecular formula C13H13ClFNO5S and a molecular weight of 349.77 g/mol. Its IUPAC name is 1-[2-(4-chlorophenyl)sulfonylacetyl]-3-fluoropyrrolidine-3-carboxylic acid.
| Compound Name | 1-[2-(4-chlorophenyl)sulfonylacetyl]-3-fluoropyrrolidine-3-carboxylic acid |
|---|---|
| PubChem CID | 119259327 |
| Molecular Formula | C13H13ClFNO5S |
| Molecular Weight | 349.77 g/mol |
| Exact Mass | 349.02 |
| IUPAC Name | 1-[2-(4-chlorophenyl)sulfonylacetyl]-3-fluoropyrrolidine-3-carboxylic acid |
| SMILES | O=C(CS(=O)(=O)c1ccc(Cl)cc1)N1CCC(F)(C(=O)O)C1 |
| InChI | InChI=1S/C13H13ClFNO5S/c14-9-1-3-10(4-2-9)22(20,21)7-11(17)16-6-5-13(15,8-16)12(18)19/h1-4H,5-8H2,(H,18,19) |
| InChIKey | CABNURKZLUQNAL-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 91.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.77 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |