C16H20FNO5S — CID 120529820
1-[3-(4-ethylsulfonylphenyl)propanoyl]-3-fluoropyrrolidine-3-carboxylic acid (PubChem CID 120529820) has the molecular formula C16H20FNO5S and a molecular weight of 357.40 g/mol. Its IUPAC name is 1-[3-(4-ethylsulfonylphenyl)propanoyl]-3-fluoropyrrolidine-3-carboxylic acid.
| Compound Name | 1-[3-(4-ethylsulfonylphenyl)propanoyl]-3-fluoropyrrolidine-3-carboxylic acid |
|---|---|
| PubChem CID | 120529820 |
| Molecular Formula | C16H20FNO5S |
| Molecular Weight | 357.40 g/mol |
| Exact Mass | 357.10 |
| IUPAC Name | 1-[3-(4-ethylsulfonylphenyl)propanoyl]-3-fluoropyrrolidine-3-carboxylic acid |
| SMILES | CCS(=O)(=O)c1ccc(CCC(=O)N2CCC(F)(C(=O)O)C2)cc1 |
| InChI | InChI=1S/C16H20FNO5S/c1-2-24(22,23)13-6-3-12(4-7-13)5-8-14(19)18-10-9-16(17,11-18)15(20)21/h3-4,6-7H,2,5,8-11H2,1H3,(H,20,21) |
| InChIKey | DMRCKHNKIVYYRA-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 91.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.40 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |