C14H16FNO3S — CID 119259342
3-fluoro-1-(3-phenylsulfanylpropanoyl)pyrrolidine-3-carboxylic acid (PubChem CID 119259342) has the molecular formula C14H16FNO3S and a molecular weight of 297.35 g/mol. Its IUPAC name is 3-fluoro-1-(3-phenylsulfanylpropanoyl)pyrrolidine-3-carboxylic acid.
| Compound Name | 3-fluoro-1-(3-phenylsulfanylpropanoyl)pyrrolidine-3-carboxylic acid |
|---|---|
| PubChem CID | 119259342 |
| Molecular Formula | C14H16FNO3S |
| Molecular Weight | 297.35 g/mol |
| Exact Mass | 297.08 |
| IUPAC Name | 3-fluoro-1-(3-phenylsulfanylpropanoyl)pyrrolidine-3-carboxylic acid |
| SMILES | O=C(CCSc1ccccc1)N1CCC(F)(C(=O)O)C1 |
| InChI | InChI=1S/C14H16FNO3S/c15-14(13(18)19)7-8-16(10-14)12(17)6-9-20-11-4-2-1-3-5-11/h1-5H,6-10H2,(H,18,19) |
| InChIKey | JOCOVUADAHHIKA-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.35 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |