C15H17F2NO4 — CID 119257990
3-fluoro-1-[4-(3-fluorophenoxy)butanoyl]pyrrolidine-3-carboxylic acid (PubChem CID 119257990) has the molecular formula C15H17F2NO4 and a molecular weight of 313.30 g/mol. Its IUPAC name is 3-fluoro-1-[4-(3-fluorophenoxy)butanoyl]pyrrolidine-3-carboxylic acid.
| Compound Name | 3-fluoro-1-[4-(3-fluorophenoxy)butanoyl]pyrrolidine-3-carboxylic acid |
|---|---|
| PubChem CID | 119257990 |
| Molecular Formula | C15H17F2NO4 |
| Molecular Weight | 313.30 g/mol |
| Exact Mass | 313.11 |
| IUPAC Name | 3-fluoro-1-[4-(3-fluorophenoxy)butanoyl]pyrrolidine-3-carboxylic acid |
| SMILES | O=C(CCCOc1cccc(F)c1)N1CCC(F)(C(=O)O)C1 |
| InChI | InChI=1S/C15H17F2NO4/c16-11-3-1-4-12(9-11)22-8-2-5-13(19)18-7-6-15(17,10-18)14(20)21/h1,3-4,9H,2,5-8,10H2,(H,20,21) |
| InChIKey | PLGYIGVLYXYFIS-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.30 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|