C21H21Cl2FN2O3 — CID 55939281
1-[4-(3,5-dichlorobenzoyl)piperazin-1-yl]-4-(3-fluorophenoxy)butan-1-one (PubChem CID 55939281) has the molecular formula C21H21Cl2FN2O3 and a molecular weight of 439.31 g/mol. Its IUPAC name is 1-[4-(3,5-dichlorobenzoyl)piperazin-1-yl]-4-(3-fluorophenoxy)butan-1-one.
| Compound Name | 1-[4-(3,5-dichlorobenzoyl)piperazin-1-yl]-4-(3-fluorophenoxy)butan-1-one |
|---|---|
| PubChem CID | 55939281 |
| Molecular Formula | C21H21Cl2FN2O3 |
| Molecular Weight | 439.31 g/mol |
| Exact Mass | 438.09 |
| IUPAC Name | 1-[4-(3,5-dichlorobenzoyl)piperazin-1-yl]-4-(3-fluorophenoxy)butan-1-one |
| SMILES | O=C(CCCOc1cccc(F)c1)N1CCN(C(=O)c2cc(Cl)cc(Cl)c2)CC1 |
| InChI | InChI=1S/C21H21Cl2FN2O3/c22-16-11-15(12-17(23)13-16)21(28)26-8-6-25(7-9-26)20(27)5-2-10-29-19-4-1-3-18(24)14-19/h1,3-4,11-14H,2,5-10H2 |
| InChIKey | LOANQUJRXRRXMJ-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.31 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|