C25H31FN2O3 — CID 108536225
4-(4-tert-butylphenoxy)-1-[4-(3-fluorobenzoyl)piperazin-1-yl]butan-1-one (PubChem CID 108536225) has the molecular formula C25H31FN2O3 and a molecular weight of 426.53 g/mol. Its IUPAC name is 4-(4-tert-butylphenoxy)-1-[4-(3-fluorobenzoyl)piperazin-1-yl]butan-1-one.
| Compound Name | 4-(4-tert-butylphenoxy)-1-[4-(3-fluorobenzoyl)piperazin-1-yl]butan-1-one |
|---|---|
| PubChem CID | 108536225 |
| Molecular Formula | C25H31FN2O3 |
| Molecular Weight | 426.53 g/mol |
| Exact Mass | 426.23 |
| IUPAC Name | 4-(4-tert-butylphenoxy)-1-[4-(3-fluorobenzoyl)piperazin-1-yl]butan-1-one |
| SMILES | CC(C)(C)c1ccc(OCCCC(=O)N2CCN(C(=O)c3cccc(F)c3)CC2)cc1 |
| InChI | InChI=1S/C25H31FN2O3/c1-25(2,3)20-9-11-22(12-10-20)31-17-5-8-23(29)27-13-15-28(16-14-27)24(30)19-6-4-7-21(26)18-19/h4,6-7,9-12,18H,5,8,13-17H2,1-3H3 |
| InChIKey | BZEDKMJEJXWJTC-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.53 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|