C23H36N2O4 — CID 108546973
4-(4-tert-butylphenoxy)-1-[4-(3-methoxypropanoyl)-1,4-diazepan-1-yl]butan-1-one (PubChem CID 108546973) has the molecular formula C23H36N2O4 and a molecular weight of 404.55 g/mol. Its IUPAC name is 4-(4-tert-butylphenoxy)-1-[4-(3-methoxypropanoyl)-1,4-diazepan-1-yl]butan-1-one.
| Compound Name | 4-(4-tert-butylphenoxy)-1-[4-(3-methoxypropanoyl)-1,4-diazepan-1-yl]butan-1-one |
|---|---|
| PubChem CID | 108546973 |
| Molecular Formula | C23H36N2O4 |
| Molecular Weight | 404.55 g/mol |
| Exact Mass | 404.27 |
| IUPAC Name | 4-(4-tert-butylphenoxy)-1-[4-(3-methoxypropanoyl)-1,4-diazepan-1-yl]butan-1-one |
| SMILES | COCCC(=O)N1CCCN(C(=O)CCCOc2ccc(C(C)(C)C)cc2)CC1 |
| InChI | InChI=1S/C23H36N2O4/c1-23(2,3)19-8-10-20(11-9-19)29-17-5-7-21(26)24-13-6-14-25(16-15-24)22(27)12-18-28-4/h8-11H,5-7,12-18H2,1-4H3 |
| InChIKey | OGPKWXZIOHAYLR-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.55 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|