C24H38N2O3 — CID 108546968
1-[4-[4-(4-tert-butylphenoxy)butanoyl]-1,4-diazepan-1-yl]pentan-1-one (PubChem CID 108546968) has the molecular formula C24H38N2O3 and a molecular weight of 402.58 g/mol. Its IUPAC name is 1-[4-[4-(4-tert-butylphenoxy)butanoyl]-1,4-diazepan-1-yl]pentan-1-one.
| Compound Name | 1-[4-[4-(4-tert-butylphenoxy)butanoyl]-1,4-diazepan-1-yl]pentan-1-one |
|---|---|
| PubChem CID | 108546968 |
| Molecular Formula | C24H38N2O3 |
| Molecular Weight | 402.58 g/mol |
| Exact Mass | 402.29 |
| IUPAC Name | 1-[4-[4-(4-tert-butylphenoxy)butanoyl]-1,4-diazepan-1-yl]pentan-1-one |
| SMILES | CCCCC(=O)N1CCCN(C(=O)CCCOc2ccc(C(C)(C)C)cc2)CC1 |
| InChI | InChI=1S/C24H38N2O3/c1-5-6-9-22(27)25-15-8-16-26(18-17-25)23(28)10-7-19-29-21-13-11-20(12-14-21)24(2,3)4/h11-14H,5-10,15-19H2,1-4H3 |
| InChIKey | FDFMNHDMZVDRIR-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.58 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|