C23H31N3O4 — CID 108569080
4-(4-tert-butylphenoxy)-1-[4-(5-methyl-1,2-oxazole-3-carbonyl)piperazin-1-yl]butan-1-one (PubChem CID 108569080) has the molecular formula C23H31N3O4 and a molecular weight of 413.52 g/mol. Its IUPAC name is 4-(4-tert-butylphenoxy)-1-[4-(5-methyl-1,2-oxazole-3-carbonyl)piperazin-1-yl]butan-1-one.
| Compound Name | 4-(4-tert-butylphenoxy)-1-[4-(5-methyl-1,2-oxazole-3-carbonyl)piperazin-1-yl]butan-1-one |
|---|---|
| PubChem CID | 108569080 |
| Molecular Formula | C23H31N3O4 |
| Molecular Weight | 413.52 g/mol |
| Exact Mass | 413.23 |
| IUPAC Name | 4-(4-tert-butylphenoxy)-1-[4-(5-methyl-1,2-oxazole-3-carbonyl)piperazin-1-yl]butan-1-one |
| SMILES | Cc1cc(C(=O)N2CCN(C(=O)CCCOc3ccc(C(C)(C)C)cc3)CC2)no1 |
| InChI | InChI=1S/C23H31N3O4/c1-17-16-20(24-30-17)22(28)26-13-11-25(12-14-26)21(27)6-5-15-29-19-9-7-18(8-10-19)23(2,3)4/h7-10,16H,5-6,11-15H2,1-4H3 |
| InChIKey | GNVZBIMARBBJOS-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 75.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.52 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|