C19H23N3O4 — CID 110328449
1-[4-(5-methyl-1,2-oxazole-3-carbonyl)piperazin-1-yl]-4-phenoxybutan-1-one (PubChem CID 110328449) has the molecular formula C19H23N3O4 and a molecular weight of 357.41 g/mol. Its IUPAC name is 1-[4-(5-methyl-1,2-oxazole-3-carbonyl)piperazin-1-yl]-4-phenoxybutan-1-one.
| Compound Name | 1-[4-(5-methyl-1,2-oxazole-3-carbonyl)piperazin-1-yl]-4-phenoxybutan-1-one |
|---|---|
| PubChem CID | 110328449 |
| Molecular Formula | C19H23N3O4 |
| Molecular Weight | 357.41 g/mol |
| Exact Mass | 357.17 |
| IUPAC Name | 1-[4-(5-methyl-1,2-oxazole-3-carbonyl)piperazin-1-yl]-4-phenoxybutan-1-one |
| SMILES | Cc1cc(C(=O)N2CCN(C(=O)CCCOc3ccccc3)CC2)no1 |
| InChI | InChI=1S/C19H23N3O4/c1-15-14-17(20-26-15)19(24)22-11-9-21(10-12-22)18(23)8-5-13-25-16-6-3-2-4-7-16/h2-4,6-7,14H,5,8-13H2,1H3 |
| InChIKey | JTCMWFKQOHQURR-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 75.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.41 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|