C23H34N2O4 — CID 108536229
1-[4-[4-(4-tert-butylphenoxy)butanoyl]piperazin-1-yl]pentane-1,4-dione (PubChem CID 108536229) has the molecular formula C23H34N2O4 and a molecular weight of 402.54 g/mol. Its IUPAC name is 1-[4-[4-(4-tert-butylphenoxy)butanoyl]piperazin-1-yl]pentane-1,4-dione.
| Compound Name | 1-[4-[4-(4-tert-butylphenoxy)butanoyl]piperazin-1-yl]pentane-1,4-dione |
|---|---|
| PubChem CID | 108536229 |
| Molecular Formula | C23H34N2O4 |
| Molecular Weight | 402.54 g/mol |
| Exact Mass | 402.25 |
| IUPAC Name | 1-[4-[4-(4-tert-butylphenoxy)butanoyl]piperazin-1-yl]pentane-1,4-dione |
| SMILES | CC(=O)CCC(=O)N1CCN(C(=O)CCCOc2ccc(C(C)(C)C)cc2)CC1 |
| InChI | InChI=1S/C23H34N2O4/c1-18(26)7-12-22(28)25-15-13-24(14-16-25)21(27)6-5-17-29-20-10-8-19(9-11-20)23(2,3)4/h8-11H,5-7,12-17H2,1-4H3 |
| InChIKey | VMISIPGWXREVSM-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.54 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|