C28H38N2O3 — CID 108546967
4-(4-tert-butylphenoxy)-1-[4-(3-phenylpropanoyl)-1,4-diazepan-1-yl]butan-1-one (PubChem CID 108546967) has the molecular formula C28H38N2O3 and a molecular weight of 450.62 g/mol. Its IUPAC name is 4-(4-tert-butylphenoxy)-1-[4-(3-phenylpropanoyl)-1,4-diazepan-1-yl]butan-1-one.
| Compound Name | 4-(4-tert-butylphenoxy)-1-[4-(3-phenylpropanoyl)-1,4-diazepan-1-yl]butan-1-one |
|---|---|
| PubChem CID | 108546967 |
| Molecular Formula | C28H38N2O3 |
| Molecular Weight | 450.62 g/mol |
| Exact Mass | 450.29 |
| IUPAC Name | 4-(4-tert-butylphenoxy)-1-[4-(3-phenylpropanoyl)-1,4-diazepan-1-yl]butan-1-one |
| SMILES | CC(C)(C)c1ccc(OCCCC(=O)N2CCCN(C(=O)CCc3ccccc3)CC2)cc1 |
| InChI | InChI=1S/C28H38N2O3/c1-28(2,3)24-13-15-25(16-14-24)33-22-7-11-26(31)29-18-8-19-30(21-20-29)27(32)17-12-23-9-5-4-6-10-23/h4-6,9-10,13-16H,7-8,11-12,17-22H2,1-3H3 |
| InChIKey | ZNAGKOYHVCAEQF-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.62 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|