C25H35N3O4 — CID 86877441
4-(4-tert-butylphenoxy)-1-[4-[2-(3,5-dimethyl-1,2-oxazol-4-yl)acetyl]piperazin-1-yl]butan-1-one (PubChem CID 86877441) has the molecular formula C25H35N3O4 and a molecular weight of 441.57 g/mol. Its IUPAC name is 4-(4-tert-butylphenoxy)-1-[4-[2-(3,5-dimethyl-1,2-oxazol-4-yl)acetyl]piperazin-1-yl]butan-1-one.
| Compound Name | 4-(4-tert-butylphenoxy)-1-[4-[2-(3,5-dimethyl-1,2-oxazol-4-yl)acetyl]piperazin-1-yl]butan-1-one |
|---|---|
| PubChem CID | 86877441 |
| Molecular Formula | C25H35N3O4 |
| Molecular Weight | 441.57 g/mol |
| Exact Mass | 441.26 |
| IUPAC Name | 4-(4-tert-butylphenoxy)-1-[4-[2-(3,5-dimethyl-1,2-oxazol-4-yl)acetyl]piperazin-1-yl]butan-1-one |
| SMILES | Cc1noc(C)c1CC(=O)N1CCN(C(=O)CCCOc2ccc(C(C)(C)C)cc2)CC1 |
| InChI | InChI=1S/C25H35N3O4/c1-18-22(19(2)32-26-18)17-24(30)28-14-12-27(13-15-28)23(29)7-6-16-31-21-10-8-20(9-11-21)25(3,4)5/h8-11H,6-7,12-17H2,1-5H3 |
| InChIKey | HJHTVWRANCAGRR-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 75.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.57 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|